C23H26F2N6 — CID 1443443
1-[(S)-(1-cyclopentyltetrazol-5-yl)-(4-fluorophenyl)methyl]-4-(4-fluorophenyl)piperazine (PubChem CID 1443443) has the molecular formula C23H26F2N6 and a molecular weight of 424.50 g/mol. Its IUPAC name is 1-[(S)-(1-cyclopentyltetrazol-5-yl)-(4-fluorophenyl)methyl]-4-(4-fluorophenyl)piperazine.
| Compound Name | 1-[(S)-(1-cyclopentyltetrazol-5-yl)-(4-fluorophenyl)methyl]-4-(4-fluorophenyl)piperazine |
|---|---|
| PubChem CID | 1443443 |
| Molecular Formula | C23H26F2N6 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 1-[(S)-(1-cyclopentyltetrazol-5-yl)-(4-fluorophenyl)methyl]-4-(4-fluorophenyl)piperazine |
| SMILES | Fc1ccc([C@@H](c2nnnn2C2CCCC2)N2CCN(c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H26F2N6/c24-18-7-5-17(6-8-18)22(23-26-27-28-31(23)21-3-1-2-4-21)30-15-13-29(14-16-30)20-11-9-19(25)10-12-20/h5-12,21-22H,1-4,13-16H2/t22-/m0/s1 |
| InChIKey | FEUJZSZYVHDEJQ-QFIPXVFZSA-N |
| XLogP | 3.98 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |