C18H24FN5 — CID 3173834
1-[(1-cyclopentyltetrazol-5-yl)-(4-fluorophenyl)methyl]piperidine (PubChem CID 3173834) has the molecular formula C18H24FN5 and a molecular weight of 329.42 g/mol. Its IUPAC name is 1-[(1-cyclopentyltetrazol-5-yl)-(4-fluorophenyl)methyl]piperidine.
| Compound Name | 1-[(1-cyclopentyltetrazol-5-yl)-(4-fluorophenyl)methyl]piperidine |
|---|---|
| PubChem CID | 3173834 |
| Molecular Formula | C18H24FN5 |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 1-[(1-cyclopentyltetrazol-5-yl)-(4-fluorophenyl)methyl]piperidine |
| SMILES | Fc1ccc(C(c2nnnn2C2CCCC2)N2CCCCC2)cc1 |
| InChI | InChI=1S/C18H24FN5/c19-15-10-8-14(9-11-15)17(23-12-4-1-5-13-23)18-20-21-22-24(18)16-6-2-3-7-16/h8-11,16-17H,1-7,12-13H2 |
| InChIKey | SPWKYDUDUAOVHB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |