C20H32FN6+ — CID 7384018
1-[(1R)-1-(1-tert-butyltetrazol-5-yl)pentyl]-4-(2-fluorophenyl)piperazin-1-ium (PubChem CID 7384018) has the molecular formula C20H32FN6+ and a molecular weight of 375.52 g/mol. Its IUPAC name is 1-[(1R)-1-(1-tert-butyltetrazol-5-yl)pentyl]-4-(2-fluorophenyl)piperazin-1-ium.
| Compound Name | 1-[(1R)-1-(1-tert-butyltetrazol-5-yl)pentyl]-4-(2-fluorophenyl)piperazin-1-ium |
|---|---|
| PubChem CID | 7384018 |
| Molecular Formula | C20H32FN6+ |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.27 |
| IUPAC Name | 1-[(1R)-1-(1-tert-butyltetrazol-5-yl)pentyl]-4-(2-fluorophenyl)piperazin-1-ium |
| SMILES | CCCC[C@H](c1nnnn1C(C)(C)C)[NH+]1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C20H31FN6/c1-5-6-10-18(19-22-23-24-27(19)20(2,3)4)26-14-12-25(13-15-26)17-11-8-7-9-16(17)21/h7-9,11,18H,5-6,10,12-15H2,1-4H3/p+1/t18-/m1/s1 |
| InChIKey | KERCTTKKZWYQRJ-GOSISDBHSA-O |
| XLogP | 2.20 |
| TPSA | 51.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |