C22H35N6O+ — CID 7383579
1-[(1R)-1-(1-cyclohexyltetrazol-5-yl)butyl]-4-(4-methoxyphenyl)piperazin-1-ium (PubChem CID 7383579) has the molecular formula C22H35N6O+ and a molecular weight of 399.56 g/mol. Its IUPAC name is 1-[(1R)-1-(1-cyclohexyltetrazol-5-yl)butyl]-4-(4-methoxyphenyl)piperazin-1-ium.
| Compound Name | 1-[(1R)-1-(1-cyclohexyltetrazol-5-yl)butyl]-4-(4-methoxyphenyl)piperazin-1-ium |
|---|---|
| PubChem CID | 7383579 |
| Molecular Formula | C22H35N6O+ |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.29 |
| IUPAC Name | 1-[(1R)-1-(1-cyclohexyltetrazol-5-yl)butyl]-4-(4-methoxyphenyl)piperazin-1-ium |
| SMILES | CCC[C@H](c1nnnn1C1CCCCC1)[NH+]1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C22H34N6O/c1-3-7-21(22-23-24-25-28(22)19-8-5-4-6-9-19)27-16-14-26(15-17-27)18-10-12-20(29-2)13-11-18/h10-13,19,21H,3-9,14-17H2,1-2H3/p+1/t21-/m1/s1 |
| InChIKey | GWUOZJLEFSACOU-OAQYLSRUSA-O |
| XLogP | 2.43 |
| TPSA | 60.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|