C23H30FN6O+ — CID 7389235
1-[(1S)-1-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]butyl]-4-(4-methoxyphenyl)piperazin-1-ium (PubChem CID 7389235) has the molecular formula C23H30FN6O+ and a molecular weight of 425.53 g/mol. Its IUPAC name is 1-[(1S)-1-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]butyl]-4-(4-methoxyphenyl)piperazin-1-ium.
| Compound Name | 1-[(1S)-1-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]butyl]-4-(4-methoxyphenyl)piperazin-1-ium |
|---|---|
| PubChem CID | 7389235 |
| Molecular Formula | C23H30FN6O+ |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | 1-[(1S)-1-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]butyl]-4-(4-methoxyphenyl)piperazin-1-ium |
| SMILES | CCC[C@@H](c1nnnn1Cc1ccc(F)cc1)[NH+]1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C23H29FN6O/c1-3-4-22(23-25-26-27-30(23)17-18-5-7-19(24)8-6-18)29-15-13-28(14-16-29)20-9-11-21(31-2)12-10-20/h5-12,22H,3-4,13-17H2,1-2H3/p+1/t22-/m0/s1 |
| InChIKey | KVUFGSOELGKXIN-QFIPXVFZSA-O |
| XLogP | 2.12 |
| TPSA | 60.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|