C21H29N6O2+ — CID 7389350
1-[(1S)-1-[1-(furan-2-ylmethyl)tetrazol-5-yl]butyl]-4-(4-methoxyphenyl)piperazin-1-ium (PubChem CID 7389350) has the molecular formula C21H29N6O2+ and a molecular weight of 397.50 g/mol. Its IUPAC name is 1-[(1S)-1-[1-(furan-2-ylmethyl)tetrazol-5-yl]butyl]-4-(4-methoxyphenyl)piperazin-1-ium.
| Compound Name | 1-[(1S)-1-[1-(furan-2-ylmethyl)tetrazol-5-yl]butyl]-4-(4-methoxyphenyl)piperazin-1-ium |
|---|---|
| PubChem CID | 7389350 |
| Molecular Formula | C21H29N6O2+ |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | 1-[(1S)-1-[1-(furan-2-ylmethyl)tetrazol-5-yl]butyl]-4-(4-methoxyphenyl)piperazin-1-ium |
| SMILES | CCC[C@@H](c1nnnn1Cc1ccco1)[NH+]1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C21H28N6O2/c1-3-5-20(21-22-23-24-27(21)16-19-6-4-15-29-19)26-13-11-25(12-14-26)17-7-9-18(28-2)10-8-17/h4,6-10,15,20H,3,5,11-14,16H2,1-2H3/p+1/t20-/m0/s1 |
| InChIKey | KHZIJWHXZOQCSU-FQEVSTJZSA-O |
| XLogP | 1.57 |
| TPSA | 73.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|