C24H25FN6O2 — CID 3210085
1-[(4-fluorophenyl)-[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]-4-(4-methoxyphenyl)piperazine (PubChem CID 3210085) has the molecular formula C24H25FN6O2 and a molecular weight of 448.50 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)-[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]-4-(4-methoxyphenyl)piperazine.
| Compound Name | 1-[(4-fluorophenyl)-[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]-4-(4-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 3210085 |
| Molecular Formula | C24H25FN6O2 |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | 1-[(4-fluorophenyl)-[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]-4-(4-methoxyphenyl)piperazine |
| SMILES | COc1ccc(N2CCN(C(c3ccc(F)cc3)c3nnnn3Cc3ccco3)CC2)cc1 |
| InChI | InChI=1S/C24H25FN6O2/c1-32-21-10-8-20(9-11-21)29-12-14-30(15-13-29)23(18-4-6-19(25)7-5-18)24-26-27-28-31(24)17-22-3-2-16-33-22/h2-11,16,23H,12-15,17H2,1H3 |
| InChIKey | SDXWKIBNRYEYPB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|