C20H25FN6O — CID 1447045
1-(4-fluorophenyl)-4-[(1S)-1-[1-(furan-2-ylmethyl)tetrazol-5-yl]butyl]piperazine (PubChem CID 1447045) has the molecular formula C20H25FN6O and a molecular weight of 384.46 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[(1S)-1-[1-(furan-2-ylmethyl)tetrazol-5-yl]butyl]piperazine.
| Compound Name | 1-(4-fluorophenyl)-4-[(1S)-1-[1-(furan-2-ylmethyl)tetrazol-5-yl]butyl]piperazine |
|---|---|
| PubChem CID | 1447045 |
| Molecular Formula | C20H25FN6O |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[(1S)-1-[1-(furan-2-ylmethyl)tetrazol-5-yl]butyl]piperazine |
| SMILES | CCC[C@@H](c1nnnn1Cc1ccco1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H25FN6O/c1-2-4-19(20-22-23-24-27(20)15-18-5-3-14-28-18)26-12-10-25(11-13-26)17-8-6-16(21)7-9-17/h3,5-9,14,19H,2,4,10-13,15H2,1H3/t19-/m0/s1 |
| InChIKey | IQQZFAZYSOTABT-IBGZPJMESA-N |
| XLogP | 3.12 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |