C20H25ClN6O — CID 1447031
1-(3-chlorophenyl)-4-[(1R)-1-[1-(furan-2-ylmethyl)tetrazol-5-yl]butyl]piperazine (PubChem CID 1447031) has the molecular formula C20H25ClN6O and a molecular weight of 400.91 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-[(1R)-1-[1-(furan-2-ylmethyl)tetrazol-5-yl]butyl]piperazine.
| Compound Name | 1-(3-chlorophenyl)-4-[(1R)-1-[1-(furan-2-ylmethyl)tetrazol-5-yl]butyl]piperazine |
|---|---|
| PubChem CID | 1447031 |
| Molecular Formula | C20H25ClN6O |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 1-(3-chlorophenyl)-4-[(1R)-1-[1-(furan-2-ylmethyl)tetrazol-5-yl]butyl]piperazine |
| SMILES | CCC[C@H](c1nnnn1Cc1ccco1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C20H25ClN6O/c1-2-5-19(20-22-23-24-27(20)15-18-8-4-13-28-18)26-11-9-25(10-12-26)17-7-3-6-16(21)14-17/h3-4,6-8,13-14,19H,2,5,9-12,15H2,1H3/t19-/m1/s1 |
| InChIKey | PHONESDLYAOSRO-LJQANCHMSA-N |
| XLogP | 3.63 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |