C19H23ClN6O — CID 3210088
1-[(4-chlorophenyl)-[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]-4-ethylpiperazine (PubChem CID 3210088) has the molecular formula C19H23ClN6O and a molecular weight of 386.89 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)-[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]-4-ethylpiperazine.
| Compound Name | 1-[(4-chlorophenyl)-[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]-4-ethylpiperazine |
|---|---|
| PubChem CID | 3210088 |
| Molecular Formula | C19H23ClN6O |
| Molecular Weight | 386.89 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 1-[(4-chlorophenyl)-[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]-4-ethylpiperazine |
| SMILES | CCN1CCN(C(c2ccc(Cl)cc2)c2nnnn2Cc2ccco2)CC1 |
| InChI | InChI=1S/C19H23ClN6O/c1-2-24-9-11-25(12-10-24)18(15-5-7-16(20)8-6-15)19-21-22-23-26(19)14-17-4-3-13-27-17/h3-8,13,18H,2,9-12,14H2,1H3 |
| InChIKey | XBJXIWXMCKIULH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.89 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |