C20H23FN6O — CID 1447239
1-[(R)-(4-fluorophenyl)-[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine (PubChem CID 1447239) has the molecular formula C20H23FN6O and a molecular weight of 382.44 g/mol. Its IUPAC name is 1-[(R)-(4-fluorophenyl)-[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine.
| Compound Name | 1-[(R)-(4-fluorophenyl)-[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine |
|---|---|
| PubChem CID | 1447239 |
| Molecular Formula | C20H23FN6O |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 1-[(R)-(4-fluorophenyl)-[1-(furan-2-ylmethyl)tetrazol-5-yl]methyl]-4-prop-2-enylpiperazine |
| SMILES | C=CCN1CCN([C@H](c2ccc(F)cc2)c2nnnn2Cc2ccco2)CC1 |
| InChI | InChI=1S/C20H23FN6O/c1-2-9-25-10-12-26(13-11-25)19(16-5-7-17(21)8-6-16)20-22-23-24-27(20)15-18-4-3-14-28-18/h2-8,14,19H,1,9-13,15H2/t19-/m1/s1 |
| InChIKey | SYDHSRCNLKKURM-LJQANCHMSA-N |
| XLogP | 2.35 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|