C20H26N6O2 — CID 51686019
1-ethyl-4-[(R)-[1-(furan-2-ylmethyl)tetrazol-5-yl]-(4-methoxyphenyl)methyl]piperazine (PubChem CID 51686019) has the molecular formula C20H26N6O2 and a molecular weight of 382.47 g/mol. Its IUPAC name is 1-ethyl-4-[(R)-[1-(furan-2-ylmethyl)tetrazol-5-yl]-(4-methoxyphenyl)methyl]piperazine.
| Compound Name | 1-ethyl-4-[(R)-[1-(furan-2-ylmethyl)tetrazol-5-yl]-(4-methoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 51686019 |
| Molecular Formula | C20H26N6O2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 1-ethyl-4-[(R)-[1-(furan-2-ylmethyl)tetrazol-5-yl]-(4-methoxyphenyl)methyl]piperazine |
| SMILES | CCN1CCN([C@H](c2ccc(OC)cc2)c2nnnn2Cc2ccco2)CC1 |
| InChI | InChI=1S/C20H26N6O2/c1-3-24-10-12-25(13-11-24)19(16-6-8-17(27-2)9-7-16)20-21-22-23-26(20)15-18-5-4-14-28-18/h4-9,14,19H,3,10-13,15H2,1-2H3/t19-/m1/s1 |
| InChIKey | PVDBKLVPDGPXHK-LJQANCHMSA-N |
| XLogP | 2.05 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |