C20H29FN6O — CID 7388814
1-(4-fluorophenyl)-4-[(1R)-1-[1-[[(2S)-oxolan-2-yl]methyl]tetrazol-5-yl]butyl]piperazine (PubChem CID 7388814) has the molecular formula C20H29FN6O and a molecular weight of 388.49 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[(1R)-1-[1-[[(2S)-oxolan-2-yl]methyl]tetrazol-5-yl]butyl]piperazine.
| Compound Name | 1-(4-fluorophenyl)-4-[(1R)-1-[1-[[(2S)-oxolan-2-yl]methyl]tetrazol-5-yl]butyl]piperazine |
|---|---|
| PubChem CID | 7388814 |
| Molecular Formula | C20H29FN6O |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[(1R)-1-[1-[[(2S)-oxolan-2-yl]methyl]tetrazol-5-yl]butyl]piperazine |
| SMILES | CCC[C@H](c1nnnn1C[C@@H]1CCCO1)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H29FN6O/c1-2-4-19(20-22-23-24-27(20)15-18-5-3-14-28-18)26-12-10-25(11-13-26)17-8-6-16(21)7-9-17/h6-9,18-19H,2-5,10-15H2,1H3/t18-,19+/m0/s1 |
| InChIKey | IHMHLQQTDROYTA-RBUKOAKNSA-N |
| XLogP | 2.65 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |