C17H23FN6O — CID 3209522
1-(4-fluorophenyl)-4-[[1-(oxolan-2-ylmethyl)tetrazol-5-yl]methyl]piperazine (PubChem CID 3209522) has the molecular formula C17H23FN6O and a molecular weight of 346.41 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[[1-(oxolan-2-ylmethyl)tetrazol-5-yl]methyl]piperazine.
| Compound Name | 1-(4-fluorophenyl)-4-[[1-(oxolan-2-ylmethyl)tetrazol-5-yl]methyl]piperazine |
|---|---|
| PubChem CID | 3209522 |
| Molecular Formula | C17H23FN6O |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[[1-(oxolan-2-ylmethyl)tetrazol-5-yl]methyl]piperazine |
| SMILES | Fc1ccc(N2CCN(Cc3nnnn3CC3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C17H23FN6O/c18-14-3-5-15(6-4-14)23-9-7-22(8-10-23)13-17-19-20-21-24(17)12-16-2-1-11-25-16/h3-6,16H,1-2,7-13H2 |
| InChIKey | KYDWBSSJLPUDIH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |