C23H29FN6O — CID 1446489
1-[(1S)-1-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-2-methylpropyl]-4-(4-methoxyphenyl)piperazine (PubChem CID 1446489) has the molecular formula C23H29FN6O and a molecular weight of 424.52 g/mol. Its IUPAC name is 1-[(1S)-1-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-2-methylpropyl]-4-(4-methoxyphenyl)piperazine.
| Compound Name | 1-[(1S)-1-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-2-methylpropyl]-4-(4-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 1446489 |
| Molecular Formula | C23H29FN6O |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 1-[(1S)-1-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-2-methylpropyl]-4-(4-methoxyphenyl)piperazine |
| SMILES | COc1ccc(N2CCN([C@H](c3nnnn3Cc3ccc(F)cc3)C(C)C)CC2)cc1 |
| InChI | InChI=1S/C23H29FN6O/c1-17(2)22(23-25-26-27-30(23)16-18-4-6-19(24)7-5-18)29-14-12-28(13-15-29)20-8-10-21(31-3)11-9-20/h4-11,17,22H,12-16H2,1-3H3/t22-/m0/s1 |
| InChIKey | ABMCJJCWZHKGDK-QFIPXVFZSA-N |
| XLogP | 3.39 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|