C16H22FN5O — CID 3823345
4-[1-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-2-methylpropyl]morpholine (PubChem CID 3823345) has the molecular formula C16H22FN5O and a molecular weight of 319.38 g/mol. Its IUPAC name is 4-[1-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-2-methylpropyl]morpholine.
| Compound Name | 4-[1-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-2-methylpropyl]morpholine |
|---|---|
| PubChem CID | 3823345 |
| Molecular Formula | C16H22FN5O |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 4-[1-[1-[(4-fluorophenyl)methyl]tetrazol-5-yl]-2-methylpropyl]morpholine |
| SMILES | CC(C)C(c1nnnn1Cc1ccc(F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C16H22FN5O/c1-12(2)15(21-7-9-23-10-8-21)16-18-19-20-22(16)11-13-3-5-14(17)6-4-13/h3-6,12,15H,7-11H2,1-2H3 |
| InChIKey | ZJFUCPMYMGALFF-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |