C22H34N6O — CID 3208700
1-[1-(1-cyclopentyltetrazol-5-yl)pentyl]-4-(4-methoxyphenyl)piperazine (PubChem CID 3208700) has the molecular formula C22H34N6O and a molecular weight of 398.56 g/mol. Its IUPAC name is 1-[1-(1-cyclopentyltetrazol-5-yl)pentyl]-4-(4-methoxyphenyl)piperazine.
| Compound Name | 1-[1-(1-cyclopentyltetrazol-5-yl)pentyl]-4-(4-methoxyphenyl)piperazine |
|---|---|
| PubChem CID | 3208700 |
| Molecular Formula | C22H34N6O |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | 1-[1-(1-cyclopentyltetrazol-5-yl)pentyl]-4-(4-methoxyphenyl)piperazine |
| SMILES | CCCCC(c1nnnn1C1CCCC1)N1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C22H34N6O/c1-3-4-9-21(22-23-24-25-28(22)19-7-5-6-8-19)27-16-14-26(15-17-27)18-10-12-20(29-2)13-11-18/h10-13,19,21H,3-9,14-17H2,1-2H3 |
| InChIKey | VMELBMIAJUKECE-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|