C20H31N6+ — CID 7383550
1-[(1R)-1-(1-cyclohexyltetrazol-5-yl)propyl]-4-phenylpiperazin-1-ium (PubChem CID 7383550) has the molecular formula C20H31N6+ and a molecular weight of 355.51 g/mol. Its IUPAC name is 1-[(1R)-1-(1-cyclohexyltetrazol-5-yl)propyl]-4-phenylpiperazin-1-ium.
| Compound Name | 1-[(1R)-1-(1-cyclohexyltetrazol-5-yl)propyl]-4-phenylpiperazin-1-ium |
|---|---|
| PubChem CID | 7383550 |
| Molecular Formula | C20H31N6+ |
| Molecular Weight | 355.51 g/mol |
| Exact Mass | 355.26 |
| IUPAC Name | 1-[(1R)-1-(1-cyclohexyltetrazol-5-yl)propyl]-4-phenylpiperazin-1-ium |
| SMILES | CC[C@H](c1nnnn1C1CCCCC1)[NH+]1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H30N6/c1-2-19(20-21-22-23-26(20)18-11-7-4-8-12-18)25-15-13-24(14-16-25)17-9-5-3-6-10-17/h3,5-6,9-10,18-19H,2,4,7-8,11-16H2,1H3/p+1/t19-/m1/s1 |
| InChIKey | OWFBURJIQKUMOF-LJQANCHMSA-O |
| XLogP | 2.03 |
| TPSA | 51.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.51 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |