C21H24ClN5 — CID 7039536
N-[(S)-(3-chlorophenyl)-(1-cyclohexyltetrazol-5-yl)methyl]-2-methylaniline (PubChem CID 7039536) has the molecular formula C21H24ClN5 and a molecular weight of 381.91 g/mol. Its IUPAC name is N-[(S)-(3-chlorophenyl)-(1-cyclohexyltetrazol-5-yl)methyl]-2-methylaniline.
| Compound Name | N-[(S)-(3-chlorophenyl)-(1-cyclohexyltetrazol-5-yl)methyl]-2-methylaniline |
|---|---|
| PubChem CID | 7039536 |
| Molecular Formula | C21H24ClN5 |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | N-[(S)-(3-chlorophenyl)-(1-cyclohexyltetrazol-5-yl)methyl]-2-methylaniline |
| SMILES | Cc1ccccc1N[C@@H](c1cccc(Cl)c1)c1nnnn1C1CCCCC1 |
| InChI | InChI=1S/C21H24ClN5/c1-15-8-5-6-13-19(15)23-20(16-9-7-10-17(22)14-16)21-24-25-26-27(21)18-11-3-2-4-12-18/h5-10,13-14,18,20,23H,2-4,11-12H2,1H3/t20-/m0/s1 |
| InChIKey | DSNFAXNUEVIQDQ-FQEVSTJZSA-N |
| XLogP | 5.34 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |