C23H22Cl2N6 — CID 139234901
4-chloro-N-[(2-chloroquinolin-3-yl)-(1-cyclohexyltetrazol-5-yl)methyl]aniline (PubChem CID 139234901) has the molecular formula C23H22Cl2N6 and a molecular weight of 453.38 g/mol. Its IUPAC name is 4-chloro-N-[(2-chloroquinolin-3-yl)-(1-cyclohexyltetrazol-5-yl)methyl]aniline.
| Compound Name | 4-chloro-N-[(2-chloroquinolin-3-yl)-(1-cyclohexyltetrazol-5-yl)methyl]aniline |
|---|---|
| PubChem CID | 139234901 |
| Molecular Formula | C23H22Cl2N6 |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 4-chloro-N-[(2-chloroquinolin-3-yl)-(1-cyclohexyltetrazol-5-yl)methyl]aniline |
| SMILES | Clc1ccc(NC(c2cc3ccccc3nc2Cl)c2nnnn2C2CCCCC2)cc1 |
| InChI | InChI=1S/C23H22Cl2N6/c24-16-10-12-17(13-11-16)26-21(19-14-15-6-4-5-9-20(15)27-22(19)25)23-28-29-30-31(23)18-7-2-1-3-8-18/h4-6,9-14,18,21,26H,1-3,7-8H2 |
| InChIKey | CLUSNHMIDPXIRW-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|