C23H25N5O — CID 171368932
N-[(1-cyclohexyltetrazol-5-yl)-(4-prop-2-ynoxyphenyl)methyl]aniline (PubChem CID 171368932) has the molecular formula C23H25N5O and a molecular weight of 387.49 g/mol. Its IUPAC name is N-[(1-cyclohexyltetrazol-5-yl)-(4-prop-2-ynoxyphenyl)methyl]aniline.
| Compound Name | N-[(1-cyclohexyltetrazol-5-yl)-(4-prop-2-ynoxyphenyl)methyl]aniline |
|---|---|
| PubChem CID | 171368932 |
| Molecular Formula | C23H25N5O |
| Molecular Weight | 387.49 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | N-[(1-cyclohexyltetrazol-5-yl)-(4-prop-2-ynoxyphenyl)methyl]aniline |
| SMILES | C#CCOc1ccc(C(Nc2ccccc2)c2nnnn2C2CCCCC2)cc1 |
| InChI | InChI=1S/C23H25N5O/c1-2-17-29-21-15-13-18(14-16-21)22(24-19-9-5-3-6-10-19)23-25-26-27-28(23)20-11-7-4-8-12-20/h1,3,5-6,9-10,13-16,20,22,24H,4,7-8,11-12,17H2 |
| InChIKey | RRIWXDAVKDZDQK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|