C22H30N8 — CID 167985213
2-(3-but-3-ynyldiazirin-3-yl)-N-[(1-cyclohexyltetrazol-5-yl)-(2-ethyl-4-pyridinyl)methyl]ethanamine (PubChem CID 167985213) has the molecular formula C22H30N8 and a molecular weight of 406.54 g/mol. Its IUPAC name is 2-(3-but-3-ynyldiazirin-3-yl)-N-[(1-cyclohexyltetrazol-5-yl)-(2-ethyl-4-pyridinyl)methyl]ethanamine.
| Compound Name | 2-(3-but-3-ynyldiazirin-3-yl)-N-[(1-cyclohexyltetrazol-5-yl)-(2-ethyl-4-pyridinyl)methyl]ethanamine |
|---|---|
| PubChem CID | 167985213 |
| Molecular Formula | C22H30N8 |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 2-(3-but-3-ynyldiazirin-3-yl)-N-[(1-cyclohexyltetrazol-5-yl)-(2-ethyl-4-pyridinyl)methyl]ethanamine |
| SMILES | C#CCCC1(CCNC(c2ccnc(CC)c2)c2nnnn2C2CCCCC2)N=N1 |
| InChI | InChI=1S/C22H30N8/c1-3-5-12-22(26-27-22)13-15-24-20(17-11-14-23-18(4-2)16-17)21-25-28-29-30(21)19-9-7-6-8-10-19/h1,11,14,16,19-20,24H,4-10,12-13,15H2,2H3 |
| InChIKey | GUZYJEPJRUXZJW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 93.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|