C25H28F2N6O4 — CID 156597692
N-[(1-cyclohexyltetrazol-5-yl)-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]methyl]-4-nitroaniline (PubChem CID 156597692) has the molecular formula C25H28F2N6O4 and a molecular weight of 514.53 g/mol. Its IUPAC name is N-[(1-cyclohexyltetrazol-5-yl)-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]methyl]-4-nitroaniline.
| Compound Name | N-[(1-cyclohexyltetrazol-5-yl)-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]methyl]-4-nitroaniline |
|---|---|
| PubChem CID | 156597692 |
| Molecular Formula | C25H28F2N6O4 |
| Molecular Weight | 514.53 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | N-[(1-cyclohexyltetrazol-5-yl)-[3-(cyclopropylmethoxy)-4-(difluoromethoxy)phenyl]methyl]-4-nitroaniline |
| SMILES | O=[N+]([O-])c1ccc(NC(c2ccc(OC(F)F)c(OCC3CC3)c2)c2nnnn2C2CCCCC2)cc1 |
| InChI | InChI=1S/C25H28F2N6O4/c26-25(27)37-21-13-8-17(14-22(21)36-15-16-6-7-16)23(28-18-9-11-20(12-10-18)33(34)35)24-29-30-31-32(24)19-4-2-1-3-5-19/h8-14,16,19,23,25,28H,1-7,15H2 |
| InChIKey | HTUUCFZAFFIOOK-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.53 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|