C23H32N6O4 — CID 23968394
3-cyclohexyl-3-[[(1-cyclohexyltetrazol-5-yl)-(4-nitrophenyl)methyl]amino]propanoic acid (PubChem CID 23968394) has the molecular formula C23H32N6O4 and a molecular weight of 456.55 g/mol. Its IUPAC name is 3-cyclohexyl-3-[[(1-cyclohexyltetrazol-5-yl)-(4-nitrophenyl)methyl]amino]propanoic acid.
| Compound Name | 3-cyclohexyl-3-[[(1-cyclohexyltetrazol-5-yl)-(4-nitrophenyl)methyl]amino]propanoic acid |
|---|---|
| PubChem CID | 23968394 |
| Molecular Formula | C23H32N6O4 |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 3-cyclohexyl-3-[[(1-cyclohexyltetrazol-5-yl)-(4-nitrophenyl)methyl]amino]propanoic acid |
| SMILES | O=C(O)CC(NC(c1ccc([N+](=O)[O-])cc1)c1nnnn1C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C23H32N6O4/c30-21(31)15-20(16-7-3-1-4-8-16)24-22(17-11-13-19(14-12-17)29(32)33)23-25-26-27-28(23)18-9-5-2-6-10-18/h11-14,16,18,20,22,24H,1-10,15H2,(H,30,31) |
| InChIKey | WTHJTNNTLDMVTM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|