C25H38N6O4 — CID 23736170
3-cyclohexyl-3-[[(3-nitrophenyl)-[1-(2,4,4-trimethylpentan-2-yl)tetrazol-5-yl]methyl]amino]propanoic acid (PubChem CID 23736170) has the molecular formula C25H38N6O4 and a molecular weight of 486.62 g/mol. Its IUPAC name is 3-cyclohexyl-3-[[(3-nitrophenyl)-[1-(2,4,4-trimethylpentan-2-yl)tetrazol-5-yl]methyl]amino]propanoic acid.
| Compound Name | 3-cyclohexyl-3-[[(3-nitrophenyl)-[1-(2,4,4-trimethylpentan-2-yl)tetrazol-5-yl]methyl]amino]propanoic acid |
|---|---|
| PubChem CID | 23736170 |
| Molecular Formula | C25H38N6O4 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | 3-cyclohexyl-3-[[(3-nitrophenyl)-[1-(2,4,4-trimethylpentan-2-yl)tetrazol-5-yl]methyl]amino]propanoic acid |
| SMILES | CC(C)(C)CC(C)(C)n1nnnc1C(NC(CC(=O)O)C1CCCCC1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H38N6O4/c1-24(2,3)16-25(4,5)30-23(27-28-29-30)22(18-12-9-13-19(14-18)31(34)35)26-20(15-21(32)33)17-10-7-6-8-11-17/h9,12-14,17,20,22,26H,6-8,10-11,15-16H2,1-5H3,(H,32,33) |
| InChIKey | NTYFQIVQSUNXRD-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|