C27H29FN4O7 — CID 23938019
3-cyclohexyl-3-[[1-(4-fluorobenzoyl)-3-(3-nitrobenzoyl)imidazolidine-2-carbonyl]amino]propanoic acid (PubChem CID 23938019) has the molecular formula C27H29FN4O7 and a molecular weight of 540.55 g/mol. Its IUPAC name is 3-cyclohexyl-3-[[1-(4-fluorobenzoyl)-3-(3-nitrobenzoyl)imidazolidine-2-carbonyl]amino]propanoic acid.
| Compound Name | 3-cyclohexyl-3-[[1-(4-fluorobenzoyl)-3-(3-nitrobenzoyl)imidazolidine-2-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 23938019 |
| Molecular Formula | C27H29FN4O7 |
| Molecular Weight | 540.55 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | 3-cyclohexyl-3-[[1-(4-fluorobenzoyl)-3-(3-nitrobenzoyl)imidazolidine-2-carbonyl]amino]propanoic acid |
| SMILES | O=C(O)CC(NC(=O)C1N(C(=O)c2ccc(F)cc2)CCN1C(=O)c1cccc([N+](=O)[O-])c1)C1CCCCC1 |
| InChI | InChI=1S/C27H29FN4O7/c28-20-11-9-18(10-12-20)26(36)30-13-14-31(27(37)19-7-4-8-21(15-19)32(38)39)25(30)24(35)29-22(16-23(33)34)17-5-2-1-3-6-17/h4,7-12,15,17,22,25H,1-3,5-6,13-14,16H2,(H,29,35)(H,33,34) |
| InChIKey | MRXQNYKSLCNKSL-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 150.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|