C28H25ClN4O7 — CID 23963753
3-[[1-(4-chlorobenzoyl)-3-(3-methylbenzoyl)imidazolidine-2-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid (PubChem CID 23963753) has the molecular formula C28H25ClN4O7 and a molecular weight of 564.98 g/mol. Its IUPAC name is 3-[[1-(4-chlorobenzoyl)-3-(3-methylbenzoyl)imidazolidine-2-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid.
| Compound Name | 3-[[1-(4-chlorobenzoyl)-3-(3-methylbenzoyl)imidazolidine-2-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 23963753 |
| Molecular Formula | C28H25ClN4O7 |
| Molecular Weight | 564.98 g/mol |
| Exact Mass | 564.14 |
| IUPAC Name | 3-[[1-(4-chlorobenzoyl)-3-(3-methylbenzoyl)imidazolidine-2-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid |
| SMILES | Cc1cccc(C(=O)N2CCN(C(=O)c3ccc(Cl)cc3)C2C(=O)NC(CC(=O)O)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C28H25ClN4O7/c1-17-4-2-6-20(14-17)28(38)32-13-12-31(27(37)18-8-10-21(29)11-9-18)26(32)25(36)30-23(16-24(34)35)19-5-3-7-22(15-19)33(39)40/h2-11,14-15,23,26H,12-13,16H2,1H3,(H,30,36)(H,34,35) |
| InChIKey | DLBVZQGKNQXHDT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 150.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.98 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|