C27H24ClFN6O7 — CID 23912415
3-[[1-[(4-chlorophenyl)carbamoyl]-3-[(3-fluorophenyl)carbamoyl]imidazolidine-2-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid (PubChem CID 23912415) has the molecular formula C27H24ClFN6O7 and a molecular weight of 598.98 g/mol. Its IUPAC name is 3-[[1-[(4-chlorophenyl)carbamoyl]-3-[(3-fluorophenyl)carbamoyl]imidazolidine-2-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid.
| Compound Name | 3-[[1-[(4-chlorophenyl)carbamoyl]-3-[(3-fluorophenyl)carbamoyl]imidazolidine-2-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 23912415 |
| Molecular Formula | C27H24ClFN6O7 |
| Molecular Weight | 598.98 g/mol |
| Exact Mass | 598.14 |
| IUPAC Name | 3-[[1-[(4-chlorophenyl)carbamoyl]-3-[(3-fluorophenyl)carbamoyl]imidazolidine-2-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid |
| SMILES | O=C(O)CC(NC(=O)C1N(C(=O)Nc2ccc(Cl)cc2)CCN1C(=O)Nc1cccc(F)c1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H24ClFN6O7/c28-17-7-9-19(10-8-17)30-26(39)33-11-12-34(27(40)31-20-5-2-4-18(29)14-20)25(33)24(38)32-22(15-23(36)37)16-3-1-6-21(13-16)35(41)42/h1-10,13-14,22,25H,11-12,15H2,(H,30,39)(H,31,40)(H,32,38)(H,36,37) |
| InChIKey | LSPLXHQWSZPQSO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 174.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.98 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|