C25H26FN5O8 — CID 23933554
3-[[1-(3-fluorobenzoyl)-3-(morpholine-4-carbonyl)imidazolidine-2-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid (PubChem CID 23933554) has the molecular formula C25H26FN5O8 and a molecular weight of 543.51 g/mol. Its IUPAC name is 3-[[1-(3-fluorobenzoyl)-3-(morpholine-4-carbonyl)imidazolidine-2-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid.
| Compound Name | 3-[[1-(3-fluorobenzoyl)-3-(morpholine-4-carbonyl)imidazolidine-2-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 23933554 |
| Molecular Formula | C25H26FN5O8 |
| Molecular Weight | 543.51 g/mol |
| Exact Mass | 543.18 |
| IUPAC Name | 3-[[1-(3-fluorobenzoyl)-3-(morpholine-4-carbonyl)imidazolidine-2-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid |
| SMILES | O=C(O)CC(NC(=O)C1N(C(=O)c2cccc(F)c2)CCN1C(=O)N1CCOCC1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H26FN5O8/c26-18-5-1-4-17(13-18)24(35)29-7-8-30(25(36)28-9-11-39-12-10-28)23(29)22(34)27-20(15-21(32)33)16-3-2-6-19(14-16)31(37)38/h1-6,13-14,20,23H,7-12,15H2,(H,27,34)(H,32,33) |
| InChIKey | ONGKYYJZKVLTKG-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 162.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.51 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|