C28H26ClN5O7 — CID 23904216
3-[[1-[(4-chlorophenyl)carbamoyl]-3-(3-methylbenzoyl)imidazolidine-2-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid (PubChem CID 23904216) has the molecular formula C28H26ClN5O7 and a molecular weight of 580.00 g/mol. Its IUPAC name is 3-[[1-[(4-chlorophenyl)carbamoyl]-3-(3-methylbenzoyl)imidazolidine-2-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid.
| Compound Name | 3-[[1-[(4-chlorophenyl)carbamoyl]-3-(3-methylbenzoyl)imidazolidine-2-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 23904216 |
| Molecular Formula | C28H26ClN5O7 |
| Molecular Weight | 580.00 g/mol |
| Exact Mass | 579.15 |
| IUPAC Name | 3-[[1-[(4-chlorophenyl)carbamoyl]-3-(3-methylbenzoyl)imidazolidine-2-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid |
| SMILES | Cc1cccc(C(=O)N2CCN(C(=O)Nc3ccc(Cl)cc3)C2C(=O)NC(CC(=O)O)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C28H26ClN5O7/c1-17-4-2-6-19(14-17)27(38)32-12-13-33(28(39)30-21-10-8-20(29)9-11-21)26(32)25(37)31-23(16-24(35)36)18-5-3-7-22(15-18)34(40)41/h2-11,14-15,23,26H,12-13,16H2,1H3,(H,30,39)(H,31,37)(H,35,36) |
| InChIKey | BXLTVXRJPZGZIW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 162.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.00 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|