C25H25F2N5O8 — CID 23903778
3-[[1-(3,5-difluorobenzoyl)-3-(morpholine-4-carbonyl)imidazolidine-2-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid (PubChem CID 23903778) has the molecular formula C25H25F2N5O8 and a molecular weight of 561.50 g/mol. Its IUPAC name is 3-[[1-(3,5-difluorobenzoyl)-3-(morpholine-4-carbonyl)imidazolidine-2-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid.
| Compound Name | 3-[[1-(3,5-difluorobenzoyl)-3-(morpholine-4-carbonyl)imidazolidine-2-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 23903778 |
| Molecular Formula | C25H25F2N5O8 |
| Molecular Weight | 561.50 g/mol |
| Exact Mass | 561.17 |
| IUPAC Name | 3-[[1-(3,5-difluorobenzoyl)-3-(morpholine-4-carbonyl)imidazolidine-2-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid |
| SMILES | O=C(O)CC(NC(=O)C1N(C(=O)c2cc(F)cc(F)c2)CCN1C(=O)N1CCOCC1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H25F2N5O8/c26-17-10-16(11-18(27)13-17)24(36)30-4-5-31(25(37)29-6-8-40-9-7-29)23(30)22(35)28-20(14-21(33)34)15-2-1-3-19(12-15)32(38)39/h1-3,10-13,20,23H,4-9,14H2,(H,28,35)(H,33,34) |
| InChIKey | DHOQOMBSSNMCFK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 162.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.50 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|