C29H26N4O9 — CID 23877972
3-[[1-(1,3-benzodioxole-5-carbonyl)-3-(3-methylbenzoyl)imidazolidine-2-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid (PubChem CID 23877972) has the molecular formula C29H26N4O9 and a molecular weight of 574.55 g/mol. Its IUPAC name is 3-[[1-(1,3-benzodioxole-5-carbonyl)-3-(3-methylbenzoyl)imidazolidine-2-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid.
| Compound Name | 3-[[1-(1,3-benzodioxole-5-carbonyl)-3-(3-methylbenzoyl)imidazolidine-2-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid |
|---|---|
| PubChem CID | 23877972 |
| Molecular Formula | C29H26N4O9 |
| Molecular Weight | 574.55 g/mol |
| Exact Mass | 574.17 |
| IUPAC Name | 3-[[1-(1,3-benzodioxole-5-carbonyl)-3-(3-methylbenzoyl)imidazolidine-2-carbonyl]amino]-3-(3-nitrophenyl)propanoic acid |
| SMILES | Cc1cccc(C(=O)N2CCN(C(=O)c3ccc4c(c3)OCO4)C2C(=O)NC(CC(=O)O)c2cccc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C29H26N4O9/c1-17-4-2-6-19(12-17)28(37)31-10-11-32(29(38)20-8-9-23-24(14-20)42-16-41-23)27(31)26(36)30-22(15-25(34)35)18-5-3-7-21(13-18)33(39)40/h2-9,12-14,22,27H,10-11,15-16H2,1H3,(H,30,36)(H,34,35) |
| InChIKey | GTOGSKQHQRRYAR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 168.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.55 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|