C18H27N7O2 — CID 23904250
4-N-[(1-butyltetrazol-5-yl)-(3-nitrophenyl)methyl]cyclohexane-1,4-diamine (PubChem CID 23904250) has the molecular formula C18H27N7O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 4-N-[(1-butyltetrazol-5-yl)-(3-nitrophenyl)methyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-[(1-butyltetrazol-5-yl)-(3-nitrophenyl)methyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 23904250 |
| Molecular Formula | C18H27N7O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 4-N-[(1-butyltetrazol-5-yl)-(3-nitrophenyl)methyl]cyclohexane-1,4-diamine |
| SMILES | CCCCn1nnnc1C(NC1CCC(N)CC1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H27N7O2/c1-2-3-11-24-18(21-22-23-24)17(20-15-9-7-14(19)8-10-15)13-5-4-6-16(12-13)25(26)27/h4-6,12,14-15,17,20H,2-3,7-11,19H2,1H3 |
| InChIKey | FARCSFFYXMJYJV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|