C12H16N6O2 — CID 4725630
1-butyl-N-[(3-nitrophenyl)methyl]tetrazol-5-amine (PubChem CID 4725630) has the molecular formula C12H16N6O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 1-butyl-N-[(3-nitrophenyl)methyl]tetrazol-5-amine.
| Compound Name | 1-butyl-N-[(3-nitrophenyl)methyl]tetrazol-5-amine |
|---|---|
| PubChem CID | 4725630 |
| Molecular Formula | C12H16N6O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 1-butyl-N-[(3-nitrophenyl)methyl]tetrazol-5-amine |
| SMILES | CCCCn1nnnc1NCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H16N6O2/c1-2-3-7-17-12(14-15-16-17)13-9-10-5-4-6-11(8-10)18(19)20/h4-6,8H,2-3,7,9H2,1H3,(H,13,14,16) |
| InChIKey | CGXGRDBSOPAUDP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|