C18H26N6O3 — CID 23961348
methyl 2-[5-[[(4-aminocyclohexyl)amino]-(3-methoxyphenyl)methyl]tetrazol-1-yl]acetate (PubChem CID 23961348) has the molecular formula C18H26N6O3 and a molecular weight of 374.45 g/mol. Its IUPAC name is methyl 2-[5-[[(4-aminocyclohexyl)amino]-(3-methoxyphenyl)methyl]tetrazol-1-yl]acetate.
| Compound Name | methyl 2-[5-[[(4-aminocyclohexyl)amino]-(3-methoxyphenyl)methyl]tetrazol-1-yl]acetate |
|---|---|
| PubChem CID | 23961348 |
| Molecular Formula | C18H26N6O3 |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | methyl 2-[5-[[(4-aminocyclohexyl)amino]-(3-methoxyphenyl)methyl]tetrazol-1-yl]acetate |
| SMILES | COC(=O)Cn1nnnc1C(NC1CCC(N)CC1)c1cccc(OC)c1 |
| InChI | InChI=1S/C18H26N6O3/c1-26-15-5-3-4-12(10-15)17(20-14-8-6-13(19)7-9-14)18-21-22-23-24(18)11-16(25)27-2/h3-5,10,13-14,17,20H,6-9,11,19H2,1-2H3 |
| InChIKey | BDQVHRKIOWIKRK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |