C21H33ClN6O — CID 171668163
1-[(1-cyclopentyltetrazol-5-yl)-(4-ethoxyphenyl)methyl]-4-ethylpiperazine;hydrochloride (PubChem CID 171668163) has the molecular formula C21H33ClN6O and a molecular weight of 420.99 g/mol. Its IUPAC name is 1-[(1-cyclopentyltetrazol-5-yl)-(4-ethoxyphenyl)methyl]-4-ethylpiperazine;hydrochloride.
| Compound Name | 1-[(1-cyclopentyltetrazol-5-yl)-(4-ethoxyphenyl)methyl]-4-ethylpiperazine;hydrochloride |
|---|---|
| PubChem CID | 171668163 |
| Molecular Formula | C21H33ClN6O |
| Molecular Weight | 420.99 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | 1-[(1-cyclopentyltetrazol-5-yl)-(4-ethoxyphenyl)methyl]-4-ethylpiperazine;hydrochloride |
| SMILES | CCOc1ccc(C(c2nnnn2C2CCCC2)N2CCN(CC)CC2)cc1.Cl |
| InChI | InChI=1S/C21H32N6O.ClH/c1-3-25-13-15-26(16-14-25)20(17-9-11-19(12-10-17)28-4-2)21-22-23-24-27(21)18-7-5-6-8-18;/h9-12,18,20H,3-8,13-16H2,1-2H3;1H |
| InChIKey | ABKPTOOBQXRBCY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.99 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |