C17H22ClN5S — CID 649276
4-[(4-chlorophenyl)-(1-cyclopentyltetrazol-5-yl)methyl]thiomorpholine (PubChem CID 649276) has the molecular formula C17H22ClN5S and a molecular weight of 363.92 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)-(1-cyclopentyltetrazol-5-yl)methyl]thiomorpholine.
| Compound Name | 4-[(4-chlorophenyl)-(1-cyclopentyltetrazol-5-yl)methyl]thiomorpholine |
|---|---|
| PubChem CID | 649276 |
| Molecular Formula | C17H22ClN5S |
| Molecular Weight | 363.92 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 4-[(4-chlorophenyl)-(1-cyclopentyltetrazol-5-yl)methyl]thiomorpholine |
| SMILES | Clc1ccc(C(c2nnnn2C2CCCC2)N2CCSCC2)cc1 |
| InChI | InChI=1S/C17H22ClN5S/c18-14-7-5-13(6-8-14)16(22-9-11-24-12-10-22)17-19-20-21-23(17)15-3-1-2-4-15/h5-8,15-16H,1-4,9-12H2 |
| InChIKey | IMIWDYRMURQUCO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.92 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |