C20H27N6O2S+ — CID 7140828
1-[(R)-[1-(2-methoxyethyl)tetrazol-5-yl]-thiophen-2-ylmethyl]-4-(4-methoxyphenyl)piperazin-1-ium (PubChem CID 7140828) has the molecular formula C20H27N6O2S+ and a molecular weight of 415.54 g/mol. Its IUPAC name is 1-[(R)-[1-(2-methoxyethyl)tetrazol-5-yl]-thiophen-2-ylmethyl]-4-(4-methoxyphenyl)piperazin-1-ium.
| Compound Name | 1-[(R)-[1-(2-methoxyethyl)tetrazol-5-yl]-thiophen-2-ylmethyl]-4-(4-methoxyphenyl)piperazin-1-ium |
|---|---|
| PubChem CID | 7140828 |
| Molecular Formula | C20H27N6O2S+ |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 1-[(R)-[1-(2-methoxyethyl)tetrazol-5-yl]-thiophen-2-ylmethyl]-4-(4-methoxyphenyl)piperazin-1-ium |
| SMILES | COCCn1nnnc1[C@H](c1cccs1)[NH+]1CCN(c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C20H26N6O2S/c1-27-14-13-26-20(21-22-23-26)19(18-4-3-15-29-18)25-11-9-24(10-12-25)16-5-7-17(28-2)8-6-16/h3-8,15,19H,9-14H2,1-2H3/p+1/t19-/m0/s1 |
| InChIKey | HFTNYDUNNMALQQ-IBGZPJMESA-O |
| XLogP | 0.88 |
| TPSA | 69.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|