C17H25N3OS+2 — CID 9161324
[(2S)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-2-thiophen-2-ylethyl]azanium (PubChem CID 9161324) has the molecular formula C17H25N3OS+2 and a molecular weight of 319.47 g/mol. Its IUPAC name is [(2S)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-2-thiophen-2-ylethyl]azanium.
| Compound Name | [(2S)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-2-thiophen-2-ylethyl]azanium |
|---|---|
| PubChem CID | 9161324 |
| Molecular Formula | C17H25N3OS+2 |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | [(2S)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-2-thiophen-2-ylethyl]azanium |
| SMILES | COc1ccc(N2CC[NH+]([C@@H](C[NH3+])c3cccs3)CC2)cc1 |
| InChI | InChI=1S/C17H23N3OS/c1-21-15-6-4-14(5-7-15)19-8-10-20(11-9-19)16(13-18)17-3-2-12-22-17/h2-7,12,16H,8-11,13,18H2,1H3/p+2/t16-/m0/s1 |
| InChIKey | XBRAJUNYYKNYBQ-INIZCTEOSA-P |
| XLogP | 0.44 |
| TPSA | 44.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|