C19H28N3O3S2+ — CID 7086696
N-[(1S,2R)-1-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-1-thiophen-2-ylpropan-2-yl]methanesulfonamide (PubChem CID 7086696) has the molecular formula C19H28N3O3S2+ and a molecular weight of 410.59 g/mol. Its IUPAC name is N-[(1S,2R)-1-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-1-thiophen-2-ylpropan-2-yl]methanesulfonamide.
| Compound Name | N-[(1S,2R)-1-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-1-thiophen-2-ylpropan-2-yl]methanesulfonamide |
|---|---|
| PubChem CID | 7086696 |
| Molecular Formula | C19H28N3O3S2+ |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | N-[(1S,2R)-1-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-1-thiophen-2-ylpropan-2-yl]methanesulfonamide |
| SMILES | COc1ccc(N2CC[NH+]([C@H](c3cccs3)[C@@H](C)NS(C)(=O)=O)CC2)cc1 |
| InChI | InChI=1S/C19H27N3O3S2/c1-15(20-27(3,23)24)19(18-5-4-14-26-18)22-12-10-21(11-13-22)16-6-8-17(25-2)9-7-16/h4-9,14-15,19-20H,10-13H2,1-3H3/p+1/t15-,19+/m1/s1 |
| InChIKey | QQPYIFKXZFUBPW-BEFAXECRSA-O |
| XLogP | 1.14 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|