C23H34N3O2S+ — CID 7086621
N-[(1S,2S)-1-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-1-thiophen-2-ylpropan-2-yl]-2,2-dimethylpropanamide (PubChem CID 7086621) has the molecular formula C23H34N3O2S+ and a molecular weight of 416.61 g/mol. Its IUPAC name is N-[(1S,2S)-1-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-1-thiophen-2-ylpropan-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[(1S,2S)-1-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-1-thiophen-2-ylpropan-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 7086621 |
| Molecular Formula | C23H34N3O2S+ |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | N-[(1S,2S)-1-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]-1-thiophen-2-ylpropan-2-yl]-2,2-dimethylpropanamide |
| SMILES | COc1ccc(N2CC[NH+]([C@H](c3cccs3)[C@H](C)NC(=O)C(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C23H33N3O2S/c1-17(24-22(27)23(2,3)4)21(20-7-6-16-29-20)26-14-12-25(13-15-26)18-8-10-19(28-5)11-9-18/h6-11,16-17,21H,12-15H2,1-5H3,(H,24,27)/p+1/t17-,21-/m0/s1 |
| InChIKey | HBALENVETKAKHR-UWJYYQICSA-O |
| XLogP | 2.75 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|