C18H30N3O2+ — CID 9461849
(2R)-N-tert-butyl-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propanamide (PubChem CID 9461849) has the molecular formula C18H30N3O2+ and a molecular weight of 320.46 g/mol. Its IUPAC name is (2R)-N-tert-butyl-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propanamide.
| Compound Name | (2R)-N-tert-butyl-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 9461849 |
| Molecular Formula | C18H30N3O2+ |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | (2R)-N-tert-butyl-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propanamide |
| SMILES | COc1ccc(N2CC[NH+]([C@H](C)C(=O)NC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C18H29N3O2/c1-14(17(22)19-18(2,3)4)20-10-12-21(13-11-20)15-6-8-16(23-5)9-7-15/h6-9,14H,10-13H2,1-5H3,(H,19,22)/p+1/t14-/m1/s1 |
| InChIKey | QURDRNQIATUZPU-CQSZACIVSA-O |
| XLogP | 0.70 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|