C21H34N3O2+ — CID 8587141
(2R)-1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propan-1-one (PubChem CID 8587141) has the molecular formula C21H34N3O2+ and a molecular weight of 360.52 g/mol. Its IUPAC name is (2R)-1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propan-1-one.
| Compound Name | (2R)-1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propan-1-one |
|---|---|
| PubChem CID | 8587141 |
| Molecular Formula | C21H34N3O2+ |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | (2R)-1-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propan-1-one |
| SMILES | COc1ccc(N2CC[NH+]([C@H](C)C(=O)N3[C@@H](C)CCC[C@@H]3C)CC2)cc1 |
| InChI | InChI=1S/C21H33N3O2/c1-16-6-5-7-17(2)24(16)21(25)18(3)22-12-14-23(15-13-22)19-8-10-20(26-4)11-9-19/h8-11,16-18H,5-7,12-15H2,1-4H3/p+1/t16-,17-,18+/m0/s1 |
| InChIKey | SDDUOVOPMAKMEP-OKZBNKHCSA-O |
| XLogP | 1.58 |
| TPSA | 37.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|