C22H36N3O2+ — CID 11928052
(2R)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propanamide (PubChem CID 11928052) has the molecular formula C22H36N3O2+ and a molecular weight of 374.55 g/mol. Its IUPAC name is (2R)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propanamide.
| Compound Name | (2R)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 11928052 |
| Molecular Formula | C22H36N3O2+ |
| Molecular Weight | 374.55 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | (2R)-N-[(1S,2R,3R)-2,3-dimethylcyclohexyl]-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propanamide |
| SMILES | COc1ccc(N2CC[NH+]([C@H](C)C(=O)N[C@H]3CCC[C@@H](C)[C@H]3C)CC2)cc1 |
| InChI | InChI=1S/C22H35N3O2/c1-16-6-5-7-21(17(16)2)23-22(26)18(3)24-12-14-25(15-13-24)19-8-10-20(27-4)11-9-19/h8-11,16-18,21H,5-7,12-15H2,1-4H3,(H,23,26)/p+1/t16-,17-,18-,21+/m1/s1 |
| InChIKey | BVPBGTPPKOZQTP-IKVWTGGYSA-O |
| XLogP | 1.73 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.55 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|