C21H34N3O2+ — CID 9461962
(2R)-N-cycloheptyl-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propanamide (PubChem CID 9461962) has the molecular formula C21H34N3O2+ and a molecular weight of 360.52 g/mol. Its IUPAC name is (2R)-N-cycloheptyl-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propanamide.
| Compound Name | (2R)-N-cycloheptyl-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 9461962 |
| Molecular Formula | C21H34N3O2+ |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.26 |
| IUPAC Name | (2R)-N-cycloheptyl-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propanamide |
| SMILES | COc1ccc(N2CC[NH+]([C@H](C)C(=O)NC3CCCCCC3)CC2)cc1 |
| InChI | InChI=1S/C21H33N3O2/c1-17(21(25)22-18-7-5-3-4-6-8-18)23-13-15-24(16-14-23)19-9-11-20(26-2)12-10-19/h9-12,17-18H,3-8,13-16H2,1-2H3,(H,22,25)/p+1/t17-/m1/s1 |
| InChIKey | SVBXKNAHVSFOKA-QGZVFWFLSA-O |
| XLogP | 1.63 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|