C20H30N5O4+ — CID 7777019
(2R)-N-(cyclohexylcarbamoyl)-2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]propanamide (PubChem CID 7777019) has the molecular formula C20H30N5O4+ and a molecular weight of 404.49 g/mol. Its IUPAC name is (2R)-N-(cyclohexylcarbamoyl)-2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]propanamide.
| Compound Name | (2R)-N-(cyclohexylcarbamoyl)-2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 7777019 |
| Molecular Formula | C20H30N5O4+ |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | (2R)-N-(cyclohexylcarbamoyl)-2-[4-(4-nitrophenyl)piperazin-1-ium-1-yl]propanamide |
| SMILES | C[C@H](C(=O)NC(=O)NC1CCCCC1)[NH+]1CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C20H29N5O4/c1-15(19(26)22-20(27)21-16-5-3-2-4-6-16)23-11-13-24(14-12-23)17-7-9-18(10-8-17)25(28)29/h7-10,15-16H,2-6,11-14H2,1H3,(H2,21,22,26,27)/p+1/t15-/m1/s1 |
| InChIKey | YPUFMMOZMLLMTL-OAHLLOKOSA-O |
| XLogP | 0.85 |
| TPSA | 109.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|