C22H30N3O2+ — CID 9461808
(2R)-N-(2,4-dimethylphenyl)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propanamide (PubChem CID 9461808) has the molecular formula C22H30N3O2+ and a molecular weight of 368.50 g/mol. Its IUPAC name is (2R)-N-(2,4-dimethylphenyl)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propanamide.
| Compound Name | (2R)-N-(2,4-dimethylphenyl)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 9461808 |
| Molecular Formula | C22H30N3O2+ |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | (2R)-N-(2,4-dimethylphenyl)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propanamide |
| SMILES | COc1ccc(N2CC[NH+]([C@H](C)C(=O)Nc3ccc(C)cc3C)CC2)cc1 |
| InChI | InChI=1S/C22H29N3O2/c1-16-5-10-21(17(2)15-16)23-22(26)18(3)24-11-13-25(14-12-24)19-6-8-20(27-4)9-7-19/h5-10,15,18H,11-14H2,1-4H3,(H,23,26)/p+1/t18-/m1/s1 |
| InChIKey | SETZQUAFVXVAFH-GOSISDBHSA-O |
| XLogP | 2.04 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|