C20H24F2N3O2+ — CID 9461926
(2R)-N-(3,4-difluorophenyl)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propanamide (PubChem CID 9461926) has the molecular formula C20H24F2N3O2+ and a molecular weight of 376.43 g/mol. Its IUPAC name is (2R)-N-(3,4-difluorophenyl)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propanamide.
| Compound Name | (2R)-N-(3,4-difluorophenyl)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propanamide |
|---|---|
| PubChem CID | 9461926 |
| Molecular Formula | C20H24F2N3O2+ |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (2R)-N-(3,4-difluorophenyl)-2-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]propanamide |
| SMILES | COc1ccc(N2CC[NH+]([C@H](C)C(=O)Nc3ccc(F)c(F)c3)CC2)cc1 |
| InChI | InChI=1S/C20H23F2N3O2/c1-14(20(26)23-15-3-8-18(21)19(22)13-15)24-9-11-25(12-10-24)16-4-6-17(27-2)7-5-16/h3-8,13-14H,9-12H2,1-2H3,(H,23,26)/p+1/t14-/m1/s1 |
| InChIKey | QWVDJHXLJMCLRB-CQSZACIVSA-O |
| XLogP | 1.71 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|