C19H23N4O2S+ — CID 9028909
2-[(1R)-1-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]ethyl]-5-thiophen-2-yl-1,3,4-oxadiazole (PubChem CID 9028909) has the molecular formula C19H23N4O2S+ and a molecular weight of 371.49 g/mol. Its IUPAC name is 2-[(1R)-1-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]ethyl]-5-thiophen-2-yl-1,3,4-oxadiazole.
| Compound Name | 2-[(1R)-1-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]ethyl]-5-thiophen-2-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 9028909 |
| Molecular Formula | C19H23N4O2S+ |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-[(1R)-1-[4-(4-methoxyphenyl)piperazin-1-ium-1-yl]ethyl]-5-thiophen-2-yl-1,3,4-oxadiazole |
| SMILES | COc1ccc(N2CC[NH+]([C@H](C)c3nnc(-c4cccs4)o3)CC2)cc1 |
| InChI | InChI=1S/C19H22N4O2S/c1-14(18-20-21-19(25-18)17-4-3-13-26-17)22-9-11-23(12-10-22)15-5-7-16(24-2)8-6-15/h3-8,13-14H,9-12H2,1-2H3/p+1/t14-/m1/s1 |
| InChIKey | OBMVDEHEOTTWPS-CQSZACIVSA-O |
| XLogP | 2.27 |
| TPSA | 55.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|