C21H26N3O3S+ — CID 8993368
2-[(1S)-1-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)ethyl]-5-thiophen-2-yl-1,3,4-oxadiazole (PubChem CID 8993368) has the molecular formula C21H26N3O3S+ and a molecular weight of 400.52 g/mol. Its IUPAC name is 2-[(1S)-1-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)ethyl]-5-thiophen-2-yl-1,3,4-oxadiazole.
| Compound Name | 2-[(1S)-1-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)ethyl]-5-thiophen-2-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 8993368 |
| Molecular Formula | C21H26N3O3S+ |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2-[(1S)-1-(6,7-diethoxy-1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)ethyl]-5-thiophen-2-yl-1,3,4-oxadiazole |
| SMILES | CCOc1cc2c(cc1OCC)C[NH+]([C@@H](C)c1nnc(-c3cccs3)o1)CC2 |
| InChI | InChI=1S/C21H25N3O3S/c1-4-25-17-11-15-8-9-24(13-16(15)12-18(17)26-5-2)14(3)20-22-23-21(27-20)19-7-6-10-28-19/h6-7,10-12,14H,4-5,8-9,13H2,1-3H3/p+1/t14-/m0/s1 |
| InChIKey | HEPDPFVDKGPWLE-AWEZNQCLSA-O |
| XLogP | 3.30 |
| TPSA | 61.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |